C26H37ClN6O3 — CID 146345169
[4-[[5-chloro-4-[5-(cyclopropylmethyl)-1-methylpyrazol-4-yl]pyrimidin-2-yl]amino]cyclohexyl]-(7-oxoheptyl)carbamic acid (PubChem CID 146345169) has the molecular formula C26H37ClN6O3 and a molecular weight of 517.07 g/mol. Its IUPAC name is [4-[[5-chloro-4-[5-(cyclopropylmethyl)-1-methylpyrazol-4-yl]pyrimidin-2-yl]amino]cyclohexyl]-(7-oxoheptyl)carbamic acid.
| Compound Name | [4-[[5-chloro-4-[5-(cyclopropylmethyl)-1-methylpyrazol-4-yl]pyrimidin-2-yl]amino]cyclohexyl]-(7-oxoheptyl)carbamic acid |
|---|---|
| PubChem CID | 146345169 |
| Molecular Formula | C26H37ClN6O3 |
| Molecular Weight | 517.07 g/mol |
| Exact Mass | 516.26 |
| IUPAC Name | [4-[[5-chloro-4-[5-(cyclopropylmethyl)-1-methylpyrazol-4-yl]pyrimidin-2-yl]amino]cyclohexyl]-(7-oxoheptyl)carbamic acid |
| SMILES | Cn1ncc(-c2nc(NC3CCC(N(CCCCCCC=O)C(=O)O)CC3)ncc2Cl)c1CC1CC1 |
| InChI | InChI=1S/C26H37ClN6O3/c1-32-23(15-18-7-8-18)21(16-29-32)24-22(27)17-28-25(31-24)30-19-9-11-20(12-10-19)33(26(35)36)13-5-3-2-4-6-14-34/h14,16-20H,2-13,15H2,1H3,(H,35,36)(H,28,30,31) |
| InChIKey | OHYBMQHEYNOSPM-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 113.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.07 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|