C27H42ClN7O2 — CID 146345200
7-[[4-[[5-chloro-4-[5-(cyclopropylmethyl)-1-methylpyrazol-4-yl]pyrimidin-2-yl]amino]cyclohexyl]amino]-N-methoxy-N-methylheptanamide (PubChem CID 146345200) has the molecular formula C27H42ClN7O2 and a molecular weight of 532.13 g/mol. Its IUPAC name is 7-[[4-[[5-chloro-4-[5-(cyclopropylmethyl)-1-methylpyrazol-4-yl]pyrimidin-2-yl]amino]cyclohexyl]amino]-N-methoxy-N-methylheptanamide.
| Compound Name | 7-[[4-[[5-chloro-4-[5-(cyclopropylmethyl)-1-methylpyrazol-4-yl]pyrimidin-2-yl]amino]cyclohexyl]amino]-N-methoxy-N-methylheptanamide |
|---|---|
| PubChem CID | 146345200 |
| Molecular Formula | C27H42ClN7O2 |
| Molecular Weight | 532.13 g/mol |
| Exact Mass | 531.31 |
| IUPAC Name | 7-[[4-[[5-chloro-4-[5-(cyclopropylmethyl)-1-methylpyrazol-4-yl]pyrimidin-2-yl]amino]cyclohexyl]amino]-N-methoxy-N-methylheptanamide |
| SMILES | CON(C)C(=O)CCCCCCNC1CCC(Nc2ncc(Cl)c(-c3cnn(C)c3CC3CC3)n2)CC1 |
| InChI | InChI=1S/C27H42ClN7O2/c1-34-24(16-19-9-10-19)22(17-31-34)26-23(28)18-30-27(33-26)32-21-13-11-20(12-14-21)29-15-7-5-4-6-8-25(36)35(2)37-3/h17-21,29H,4-16H2,1-3H3,(H,30,32,33) |
| InChIKey | NJSXWCCUTMUBMG-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 97.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.13 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|