C25H38ClN7O — CID 146345211
7-amino-N-[4-[[5-chloro-4-[5-(cyclopropylmethyl)-1-methylpyrazol-4-yl]pyrimidin-2-yl]amino]cyclohexyl]heptanamide (PubChem CID 146345211) has the molecular formula C25H38ClN7O and a molecular weight of 488.08 g/mol. Its IUPAC name is 7-amino-N-[4-[[5-chloro-4-[5-(cyclopropylmethyl)-1-methylpyrazol-4-yl]pyrimidin-2-yl]amino]cyclohexyl]heptanamide.
| Compound Name | 7-amino-N-[4-[[5-chloro-4-[5-(cyclopropylmethyl)-1-methylpyrazol-4-yl]pyrimidin-2-yl]amino]cyclohexyl]heptanamide |
|---|---|
| PubChem CID | 146345211 |
| Molecular Formula | C25H38ClN7O |
| Molecular Weight | 488.08 g/mol |
| Exact Mass | 487.28 |
| IUPAC Name | 7-amino-N-[4-[[5-chloro-4-[5-(cyclopropylmethyl)-1-methylpyrazol-4-yl]pyrimidin-2-yl]amino]cyclohexyl]heptanamide |
| SMILES | Cn1ncc(-c2nc(NC3CCC(NC(=O)CCCCCCN)CC3)ncc2Cl)c1CC1CC1 |
| InChI | InChI=1S/C25H38ClN7O/c1-33-22(14-17-7-8-17)20(15-29-33)24-21(26)16-28-25(32-24)31-19-11-9-18(10-12-19)30-23(34)6-4-2-3-5-13-27/h15-19H,2-14,27H2,1H3,(H,30,34)(H,28,31,32) |
| InChIKey | MSIQZIUCESQXEC-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 110.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.08 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|