C16H23ClN6O — CID 156817339
2-[4-[2-[(4-aminocyclohexyl)amino]-5-chloropyrimidin-4-yl]-1-methylpyrazol-5-yl]ethanol (PubChem CID 156817339) has the molecular formula C16H23ClN6O and a molecular weight of 350.85 g/mol. Its IUPAC name is 2-[4-[2-[(4-aminocyclohexyl)amino]-5-chloropyrimidin-4-yl]-1-methylpyrazol-5-yl]ethanol.
| Compound Name | 2-[4-[2-[(4-aminocyclohexyl)amino]-5-chloropyrimidin-4-yl]-1-methylpyrazol-5-yl]ethanol |
|---|---|
| PubChem CID | 156817339 |
| Molecular Formula | C16H23ClN6O |
| Molecular Weight | 350.85 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 2-[4-[2-[(4-aminocyclohexyl)amino]-5-chloropyrimidin-4-yl]-1-methylpyrazol-5-yl]ethanol |
| SMILES | Cn1ncc(-c2nc(NC3CCC(N)CC3)ncc2Cl)c1CCO |
| InChI | InChI=1S/C16H23ClN6O/c1-23-14(6-7-24)12(8-20-23)15-13(17)9-19-16(22-15)21-11-4-2-10(18)3-5-11/h8-11,24H,2-7,18H2,1H3,(H,19,21,22) |
| InChIKey | BOOWKJBFQHAQBU-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 101.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.85 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |