C23H31ClN6 — CID 139408375
4-N-[5-chloro-4-[5-(cyclopropylmethyl)-1-methylpyrazol-4-yl]pyrimidin-2-yl]-1-N-pent-4-ynylcyclohexane-1,4-diamine (PubChem CID 139408375) has the molecular formula C23H31ClN6 and a molecular weight of 427.00 g/mol. Its IUPAC name is 4-N-[5-chloro-4-[5-(cyclopropylmethyl)-1-methylpyrazol-4-yl]pyrimidin-2-yl]-1-N-pent-4-ynylcyclohexane-1,4-diamine.
| Compound Name | 4-N-[5-chloro-4-[5-(cyclopropylmethyl)-1-methylpyrazol-4-yl]pyrimidin-2-yl]-1-N-pent-4-ynylcyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 139408375 |
| Molecular Formula | C23H31ClN6 |
| Molecular Weight | 427.00 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | 4-N-[5-chloro-4-[5-(cyclopropylmethyl)-1-methylpyrazol-4-yl]pyrimidin-2-yl]-1-N-pent-4-ynylcyclohexane-1,4-diamine |
| SMILES | C#CCCCNC1CCC(Nc2ncc(Cl)c(-c3cnn(C)c3CC3CC3)n2)CC1 |
| InChI | InChI=1S/C23H31ClN6/c1-3-4-5-12-25-17-8-10-18(11-9-17)28-23-26-15-20(24)22(29-23)19-14-27-30(2)21(19)13-16-6-7-16/h1,14-18,25H,4-13H2,2H3,(H,26,28,29) |
| InChIKey | OYIAKTLEVJWBCW-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 67.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.00 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|