C24H26N6O3 — CID 146346395
(2R,3R,3aS,6S,6aR)-6-[(2-amino-3-methylquinolin-7-yl)methyl]-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3,3a-diol (PubChem CID 146346395) has the molecular formula C24H26N6O3 and a molecular weight of 446.51 g/mol. Its IUPAC name is (2R,3R,3aS,6S,6aR)-6-[(2-amino-3-methylquinolin-7-yl)methyl]-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3,3a-diol.
| Compound Name | (2R,3R,3aS,6S,6aR)-6-[(2-amino-3-methylquinolin-7-yl)methyl]-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3,3a-diol |
|---|---|
| PubChem CID | 146346395 |
| Molecular Formula | C24H26N6O3 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | (2R,3R,3aS,6S,6aR)-6-[(2-amino-3-methylquinolin-7-yl)methyl]-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3,3a-diol |
| SMILES | Cc1cc2ccc(C[C@@H]3CC[C@@]4(O)[C@@H]3O[C@@H](n3ccc5c(N)ncnc53)[C@@H]4O)cc2nc1N |
| InChI | InChI=1S/C24H26N6O3/c1-12-8-14-3-2-13(10-17(14)29-20(12)25)9-15-4-6-24(32)18(31)23(33-19(15)24)30-7-5-16-21(26)27-11-28-22(16)30/h2-3,5,7-8,10-11,15,18-19,23,31-32H,4,6,9H2,1H3,(H2,25,29)(H2,26,27,28)/t15-,18-,19+,23+,24-/m0/s1 |
| InChIKey | ULYIYZUQPCKZDI-BSYOGBIBSA-N |
| XLogP | 2.09 |
| TPSA | 145.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |