C22H20N8O3 — CID 146350346
5-[[5-amino-2-[bis(pyridin-2-ylmethyl)amino]phenyl]diazenyl]-1,3-diazinane-2,4,6-trione (PubChem CID 146350346) has the molecular formula C22H20N8O3 and a molecular weight of 444.46 g/mol. Its IUPAC name is 5-[[5-amino-2-[bis(pyridin-2-ylmethyl)amino]phenyl]diazenyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[[5-amino-2-[bis(pyridin-2-ylmethyl)amino]phenyl]diazenyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 146350346 |
| Molecular Formula | C22H20N8O3 |
| Molecular Weight | 444.46 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | 5-[[5-amino-2-[bis(pyridin-2-ylmethyl)amino]phenyl]diazenyl]-1,3-diazinane-2,4,6-trione |
| SMILES | Nc1ccc(N(Cc2ccccn2)Cc2ccccn2)c(/N=N/C2C(=O)NC(=O)NC2=O)c1 |
| InChI | InChI=1S/C22H20N8O3/c23-14-7-8-18(17(11-14)28-29-19-20(31)26-22(33)27-21(19)32)30(12-15-5-1-3-9-24-15)13-16-6-2-4-10-25-16/h1-11,19H,12-13,23H2,(H2,26,27,31,32,33)/b29-28+ |
| InChIKey | QANIPPSKCYAKNZ-ZQHSETAFSA-N |
| XLogP | 2.08 |
| TPSA | 155.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.46 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|