C30H23ClN8O5 — CID 146350343
4-[[2-[bis(pyridin-2-ylmethyl)amino]-5-[(5-chloro-2,4-dihydroxyphenyl)diazenyl]phenyl]diazenyl]-6-nitrosobenzene-1,3-diol (PubChem CID 146350343) has the molecular formula C30H23ClN8O5 and a molecular weight of 611.02 g/mol. Its IUPAC name is 4-[[2-[bis(pyridin-2-ylmethyl)amino]-5-[(5-chloro-2,4-dihydroxyphenyl)diazenyl]phenyl]diazenyl]-6-nitrosobenzene-1,3-diol.
| Compound Name | 4-[[2-[bis(pyridin-2-ylmethyl)amino]-5-[(5-chloro-2,4-dihydroxyphenyl)diazenyl]phenyl]diazenyl]-6-nitrosobenzene-1,3-diol |
|---|---|
| PubChem CID | 146350343 |
| Molecular Formula | C30H23ClN8O5 |
| Molecular Weight | 611.02 g/mol |
| Exact Mass | 610.15 |
| IUPAC Name | 4-[[2-[bis(pyridin-2-ylmethyl)amino]-5-[(5-chloro-2,4-dihydroxyphenyl)diazenyl]phenyl]diazenyl]-6-nitrosobenzene-1,3-diol |
| SMILES | O=Nc1cc(/N=N/c2cc(/N=N/c3cc(Cl)c(O)cc3O)ccc2N(Cc2ccccn2)Cc2ccccn2)c(O)cc1O |
| InChI | InChI=1S/C30H23ClN8O5/c31-21-12-23(28(41)14-27(21)40)36-34-18-7-8-26(22(11-18)35-37-24-13-25(38-44)30(43)15-29(24)42)39(16-19-5-1-3-9-32-19)17-20-6-2-4-10-33-20/h1-15,40-43H,16-17H2/b36-34+,37-35+ |
| InChIKey | RCWGHDXFXDLQAB-VHJMTFITSA-N |
| XLogP | 8.39 |
| TPSA | 188.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.02 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|