C38H28N6O5 — CID 147026111
2'-[[3-amino-4-[bis(pyridin-2-ylmethyl)amino]phenyl]diazenyl]-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 147026111) has the molecular formula C38H28N6O5 and a molecular weight of 648.68 g/mol. Its IUPAC name is 2'-[[3-amino-4-[bis(pyridin-2-ylmethyl)amino]phenyl]diazenyl]-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 2'-[[3-amino-4-[bis(pyridin-2-ylmethyl)amino]phenyl]diazenyl]-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 147026111 |
| Molecular Formula | C38H28N6O5 |
| Molecular Weight | 648.68 g/mol |
| Exact Mass | 648.21 |
| IUPAC Name | 2'-[[3-amino-4-[bis(pyridin-2-ylmethyl)amino]phenyl]diazenyl]-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | Nc1cc(/N=N/c2cc3c(cc2O)Oc2cc(O)ccc2C32OC(=O)c3ccccc32)ccc1N(Cc1ccccn1)Cc1ccccn1 |
| InChI | InChI=1S/C38H28N6O5/c39-31-17-23(11-14-33(31)44(21-24-7-3-5-15-40-24)22-25-8-4-6-16-41-25)42-43-32-19-30-36(20-34(32)46)48-35-18-26(45)12-13-29(35)38(30)28-10-2-1-9-27(28)37(47)49-38/h1-20,45-46H,21-22,39H2/b43-42+ |
| InChIKey | AWRLSJCYAJFPMR-HBSCQBRPSA-N |
| XLogP | 7.66 |
| TPSA | 155.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.68 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|