C28H24N6O2 — CID 146350312
1-[[3-amino-4-[bis(pyridin-2-ylmethyl)amino]phenyl]diazenyl]naphthalene-2,6-diol (PubChem CID 146350312) has the molecular formula C28H24N6O2 and a molecular weight of 476.54 g/mol. Its IUPAC name is 1-[[3-amino-4-[bis(pyridin-2-ylmethyl)amino]phenyl]diazenyl]naphthalene-2,6-diol.
| Compound Name | 1-[[3-amino-4-[bis(pyridin-2-ylmethyl)amino]phenyl]diazenyl]naphthalene-2,6-diol |
|---|---|
| PubChem CID | 146350312 |
| Molecular Formula | C28H24N6O2 |
| Molecular Weight | 476.54 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | 1-[[3-amino-4-[bis(pyridin-2-ylmethyl)amino]phenyl]diazenyl]naphthalene-2,6-diol |
| SMILES | Nc1cc(/N=N/c2c(O)ccc3cc(O)ccc23)ccc1N(Cc1ccccn1)Cc1ccccn1 |
| InChI | InChI=1S/C28H24N6O2/c29-25-16-20(32-33-28-24-10-9-23(35)15-19(24)7-12-27(28)36)8-11-26(25)34(17-21-5-1-3-13-30-21)18-22-6-2-4-14-31-22/h1-16,35-36H,17-18,29H2/b33-32+ |
| InChIKey | YRVJIZFJLWWRGK-ULIFNZDWSA-N |
| XLogP | 6.25 |
| TPSA | 120.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.54 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|