C29H27N5O2 — CID 166989370
1-[[2-[[(2Z,4Z)-2-(methylideneamino)hexa-2,4-dienyl]-(pyridin-2-ylmethyl)amino]phenyl]diazenyl]naphthalene-2,7-diol (PubChem CID 166989370) has the molecular formula C29H27N5O2 and a molecular weight of 477.57 g/mol. Its IUPAC name is 1-[[2-[[(2Z,4Z)-2-(methylideneamino)hexa-2,4-dienyl]-(pyridin-2-ylmethyl)amino]phenyl]diazenyl]naphthalene-2,7-diol.
| Compound Name | 1-[[2-[[(2Z,4Z)-2-(methylideneamino)hexa-2,4-dienyl]-(pyridin-2-ylmethyl)amino]phenyl]diazenyl]naphthalene-2,7-diol |
|---|---|
| PubChem CID | 166989370 |
| Molecular Formula | C29H27N5O2 |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | 1-[[2-[[(2Z,4Z)-2-(methylideneamino)hexa-2,4-dienyl]-(pyridin-2-ylmethyl)amino]phenyl]diazenyl]naphthalene-2,7-diol |
| SMILES | C=N/C(=C\C=C/C)CN(Cc1ccccn1)c1ccccc1/N=N/c1c(O)ccc2ccc(O)cc12 |
| InChI | InChI=1S/C29H27N5O2/c1-3-4-9-22(30-2)19-34(20-23-10-7-8-17-31-23)27-12-6-5-11-26(27)32-33-29-25-18-24(35)15-13-21(25)14-16-28(29)36/h3-18,35-36H,2,19-20H2,1H3/b4-3-,22-9-,33-32+ |
| InChIKey | WYPSCCZXARGLBY-SQJBNDNMSA-N |
| XLogP | 7.23 |
| TPSA | 93.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|