C38H31N11O3 — CID 153167556
4-[[4,6-bis[bis(pyridin-2-ylmethyl)amino]-1,3,5-triazin-2-yl]diazenyl]-3-hydroxynaphthalene-2-carboxylic acid (PubChem CID 153167556) has the molecular formula C38H31N11O3 and a molecular weight of 689.74 g/mol. Its IUPAC name is 4-[[4,6-bis[bis(pyridin-2-ylmethyl)amino]-1,3,5-triazin-2-yl]diazenyl]-3-hydroxynaphthalene-2-carboxylic acid.
| Compound Name | 4-[[4,6-bis[bis(pyridin-2-ylmethyl)amino]-1,3,5-triazin-2-yl]diazenyl]-3-hydroxynaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 153167556 |
| Molecular Formula | C38H31N11O3 |
| Molecular Weight | 689.74 g/mol |
| Exact Mass | 689.26 |
| IUPAC Name | 4-[[4,6-bis[bis(pyridin-2-ylmethyl)amino]-1,3,5-triazin-2-yl]diazenyl]-3-hydroxynaphthalene-2-carboxylic acid |
| SMILES | O=C(O)c1cc2ccccc2c(/N=N/c2nc(N(Cc3ccccn3)Cc3ccccn3)nc(N(Cc3ccccn3)Cc3ccccn3)n2)c1O |
| InChI | InChI=1S/C38H31N11O3/c50-34-32(35(51)52)21-26-11-1-2-16-31(26)33(34)46-47-36-43-37(48(22-27-12-3-7-17-39-27)23-28-13-4-8-18-40-28)45-38(44-36)49(24-29-14-5-9-19-41-29)25-30-15-6-10-20-42-30/h1-21,50H,22-25H2,(H,51,52)/b47-46+ |
| InChIKey | WDOGRMMSIRYSPW-CPHIHMHPSA-N |
| XLogP | 6.84 |
| TPSA | 178.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.74 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|