C26H21N9O3 — CID 153266747
4-[[4-amino-6-[bis(pyridin-2-ylmethyl)amino]-1,3,5-triazin-2-yl]diazenyl]-3-hydroxynaphthalene-2-carboxylic acid (PubChem CID 153266747) has the molecular formula C26H21N9O3 and a molecular weight of 507.51 g/mol. Its IUPAC name is 4-[[4-amino-6-[bis(pyridin-2-ylmethyl)amino]-1,3,5-triazin-2-yl]diazenyl]-3-hydroxynaphthalene-2-carboxylic acid.
| Compound Name | 4-[[4-amino-6-[bis(pyridin-2-ylmethyl)amino]-1,3,5-triazin-2-yl]diazenyl]-3-hydroxynaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 153266747 |
| Molecular Formula | C26H21N9O3 |
| Molecular Weight | 507.51 g/mol |
| Exact Mass | 507.18 |
| IUPAC Name | 4-[[4-amino-6-[bis(pyridin-2-ylmethyl)amino]-1,3,5-triazin-2-yl]diazenyl]-3-hydroxynaphthalene-2-carboxylic acid |
| SMILES | Nc1nc(/N=N/c2c(O)c(C(=O)O)cc3ccccc23)nc(N(Cc2ccccn2)Cc2ccccn2)n1 |
| InChI | InChI=1S/C26H21N9O3/c27-24-30-25(34-33-21-19-10-2-1-7-16(19)13-20(22(21)36)23(37)38)32-26(31-24)35(14-17-8-3-5-11-28-17)15-18-9-4-6-12-29-18/h1-13,36H,14-15H2,(H,37,38)(H2,27,30,31,32)/b34-33+ |
| InChIKey | WWHWHRJLJRNJOP-JEIPZWNWSA-N |
| XLogP | 4.42 |
| TPSA | 175.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.51 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|