C13H14N2O3S — CID 146350908
3-(5-methoxy-3H-1,2-benzothiazol-2-yl)piperidine-2,6-dione (PubChem CID 146350908) has the molecular formula C13H14N2O3S and a molecular weight of 278.33 g/mol. Its IUPAC name is 3-(5-methoxy-3H-1,2-benzothiazol-2-yl)piperidine-2,6-dione.
| Compound Name | 3-(5-methoxy-3H-1,2-benzothiazol-2-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 146350908 |
| Molecular Formula | C13H14N2O3S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 3-(5-methoxy-3H-1,2-benzothiazol-2-yl)piperidine-2,6-dione |
| SMILES | COc1ccc2c(c1)CN(C1CCC(=O)NC1=O)S2 |
| InChI | InChI=1S/C13H14N2O3S/c1-18-9-2-4-11-8(6-9)7-15(19-11)10-3-5-12(16)14-13(10)17/h2,4,6,10H,3,5,7H2,1H3,(H,14,16,17) |
| InChIKey | REYWFPWCPKAZPX-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|