About 3,5-dichloro-N-[5-(2,2-dimethylpropoxy)-2-methylpentan-2-yl]benzenesulfonamide
3,5-dichloro-N-[5-(2,2-dimethylpropoxy)-2-methylpentan-2-yl]benzenesulfonamide (PubChem CID 146352834) has the molecular formula C17H27Cl2NO3S
and a molecular weight of 396.38 g/mol. Its IUPAC name is 3,5-dichloro-N-[5-(2,2-dimethylpropoxy)-2-methylpentan-2-yl]benzenesulfonamide.
Molecular Properties
| Compound Name | 3,5-dichloro-N-[5-(2,2-dimethylpropoxy)-2-methylpentan-2-yl]benzenesulfonamide |
| PubChem CID | 146352834 |
| Molecular Formula | C17H27Cl2NO3S |
| Molecular Weight | 396.38 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 3,5-dichloro-N-[5-(2,2-dimethylpropoxy)-2-methylpentan-2-yl]benzenesulfonamide |
| SMILES | CC(C)(C)COCCCC(C)(C)NS(=O)(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C17H27Cl2NO3S/c1-16(2,3)12-23-8-6-7-17(4,5)20-24(21,22)15-10-13(18)9-14(19)11-15/h9-11,20H,6-8,12H2,1-5H3 |
| InChIKey | QDIWITFUQGHDPO-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.38 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dichloro-N-[5-(2,2-dimethylpropoxy)-2-methylpentan-2-yl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dichloro-N-[5-(2,2-dimethylpropoxy)-2-methylpentan-2-yl]benzenesulfonamide?
The IUPAC name of 3,5-dichloro-N-[5-(2,2-dimethylpropoxy)-2-methylpentan-2-yl]benzenesulfonamide (CID 146352834) is 3,5-dichloro-N-[5-(2,2-dimethylpropoxy)-2-methylpentan-2-yl]benzenesulfonamide.
What is the SMILES notation for 3,5-dichloro-N-[5-(2,2-dimethylpropoxy)-2-methylpentan-2-yl]benzenesulfonamide?
The canonical SMILES for 3,5-dichloro-N-[5-(2,2-dimethylpropoxy)-2-methylpentan-2-yl]benzenesulfonamide is CC(C)(C)COCCCC(C)(C)NS(=O)(=O)c1cc(Cl)cc(Cl)c1.
What is the InChIKey of 3,5-dichloro-N-[5-(2,2-dimethylpropoxy)-2-methylpentan-2-yl]benzenesulfonamide?
The InChIKey is QDIWITFUQGHDPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27Cl2NO3S/c1-16(2,3)12-23-8-6-7-17(4,5)20-24(21,22)15-10-13(18)9-14(19)11-15/h9-11,20H,6-8,12H2,1-5H3.
What are the key properties of 3,5-dichloro-N-[5-(2,2-dimethylpropoxy)-2-methylpentan-2-yl]benzenesulfonamide?
3,5-dichloro-N-[5-(2,2-dimethylpropoxy)-2-methylpentan-2-yl]benzenesulfonamide has a molecular weight of 396.38 g/mol, XLogP of 4.89, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dichloro-N-[5-(2,2-dimethylpropoxy)-2-methylpentan-2-yl]benzenesulfonamide is sourced from PubChem (CID 146352834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).