C17H37NO3S — CID 146352884
3-(2,2-dimethylpropoxy)-N-(3-ethyl-2,2-dimethylpentan-3-yl)propane-1-sulfonamide (PubChem CID 146352884) has the molecular formula C17H37NO3S and a molecular weight of 335.55 g/mol. Its IUPAC name is 3-(2,2-dimethylpropoxy)-N-(3-ethyl-2,2-dimethylpentan-3-yl)propane-1-sulfonamide.
| Compound Name | 3-(2,2-dimethylpropoxy)-N-(3-ethyl-2,2-dimethylpentan-3-yl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 146352884 |
| Molecular Formula | C17H37NO3S |
| Molecular Weight | 335.55 g/mol |
| Exact Mass | 335.25 |
| IUPAC Name | 3-(2,2-dimethylpropoxy)-N-(3-ethyl-2,2-dimethylpentan-3-yl)propane-1-sulfonamide |
| SMILES | CCC(CC)(NS(=O)(=O)CCCOCC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C17H37NO3S/c1-9-17(10-2,16(6,7)8)18-22(19,20)13-11-12-21-14-15(3,4)5/h18H,9-14H2,1-8H3 |
| InChIKey | FKSDKGVETKZKEI-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.55 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|