C19H24N2O2 — CID 14636114
(2'R,3'R)-3'-ethylspiro[1,3-dioxolane-2,4'-7,10-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),11,13,15-tetraene] (PubChem CID 14636114) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is (2'R,3'R)-3'-ethylspiro[1,3-dioxolane-2,4'-7,10-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),11,13,15-tetraene].
| Compound Name | (2'R,3'R)-3'-ethylspiro[1,3-dioxolane-2,4'-7,10-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),11,13,15-tetraene] |
|---|---|
| PubChem CID | 14636114 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | (2'R,3'R)-3'-ethylspiro[1,3-dioxolane-2,4'-7,10-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),11,13,15-tetraene] |
| SMILES | CC[C@@H]1[C@@H]2c3cc4ccccc4n3CCN2CCC12OCCO2 |
| InChI | InChI=1S/C19H24N2O2/c1-2-15-18-17-13-14-5-3-4-6-16(14)21(17)10-9-20(18)8-7-19(15)22-11-12-23-19/h3-6,13,15,18H,2,7-12H2,1H3/t15-,18-/m1/s1 |
| InChIKey | VZIZRECSIQUFLQ-CRAIPNDOSA-N |
| XLogP | 3.17 |
| TPSA | 26.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |