C16H20F3N3O6 — CID 146361567
methyl 2-[(2R)-2-ethylpiperazin-1-yl]-5-nitrobenzoate;2,2,2-trifluoroacetic acid (PubChem CID 146361567) has the molecular formula C16H20F3N3O6 and a molecular weight of 407.35 g/mol. Its IUPAC name is methyl 2-[(2R)-2-ethylpiperazin-1-yl]-5-nitrobenzoate;2,2,2-trifluoroacetic acid.
| Compound Name | methyl 2-[(2R)-2-ethylpiperazin-1-yl]-5-nitrobenzoate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146361567 |
| Molecular Formula | C16H20F3N3O6 |
| Molecular Weight | 407.35 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | methyl 2-[(2R)-2-ethylpiperazin-1-yl]-5-nitrobenzoate;2,2,2-trifluoroacetic acid |
| SMILES | CC[C@@H]1CNCCN1c1ccc([N+](=O)[O-])cc1C(=O)OC.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H19N3O4.C2HF3O2/c1-3-10-9-15-6-7-16(10)13-5-4-11(17(19)20)8-12(13)14(18)21-2;3-2(4,5)1(6)7/h4-5,8,10,15H,3,6-7,9H2,1-2H3;(H,6,7)/t10-;/m1./s1 |
| InChIKey | CDRYBHMQPDSYGY-HNCPQSOCSA-N |
| XLogP | 2.20 |
| TPSA | 122.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.35 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|