C13H10F3N3O4 — CID 167343145
methyl 5-nitro-2-[3-(2,2,2-trifluoroethyl)pyrazol-1-yl]benzoate (PubChem CID 167343145) has the molecular formula C13H10F3N3O4 and a molecular weight of 329.23 g/mol. Its IUPAC name is methyl 5-nitro-2-[3-(2,2,2-trifluoroethyl)pyrazol-1-yl]benzoate.
| Compound Name | methyl 5-nitro-2-[3-(2,2,2-trifluoroethyl)pyrazol-1-yl]benzoate |
|---|---|
| PubChem CID | 167343145 |
| Molecular Formula | C13H10F3N3O4 |
| Molecular Weight | 329.23 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | methyl 5-nitro-2-[3-(2,2,2-trifluoroethyl)pyrazol-1-yl]benzoate |
| SMILES | COC(=O)c1cc([N+](=O)[O-])ccc1-n1ccc(CC(F)(F)F)n1 |
| InChI | InChI=1S/C13H10F3N3O4/c1-23-12(20)10-6-9(19(21)22)2-3-11(10)18-5-4-8(17-18)7-13(14,15)16/h2-6H,7H2,1H3 |
| InChIKey | IKPXBPNMGSCFOA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.23 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|