C14H25N3O8S — CID 146363009
methyl 3-[carbamoyl-(4-carbamoylcyclohexyl)amino]oxysulfonyloxy-2,2-dimethylpropanoate (PubChem CID 146363009) has the molecular formula C14H25N3O8S and a molecular weight of 395.43 g/mol. Its IUPAC name is methyl 3-[carbamoyl-(4-carbamoylcyclohexyl)amino]oxysulfonyloxy-2,2-dimethylpropanoate.
| Compound Name | methyl 3-[carbamoyl-(4-carbamoylcyclohexyl)amino]oxysulfonyloxy-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 146363009 |
| Molecular Formula | C14H25N3O8S |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | methyl 3-[carbamoyl-(4-carbamoylcyclohexyl)amino]oxysulfonyloxy-2,2-dimethylpropanoate |
| SMILES | COC(=O)C(C)(C)COS(=O)(=O)ON(C(N)=O)C1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C14H25N3O8S/c1-14(2,12(19)23-3)8-24-26(21,22)25-17(13(16)20)10-6-4-9(5-7-10)11(15)18/h9-10H,4-8H2,1-3H3,(H2,15,18)(H2,16,20) |
| InChIKey | HWXNXSQZDYDCCC-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 168.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|