C16H29N3O8S — CID 137436596
ethyl 3-[carbamoyl-(4-carbamoylcyclohexyl)amino]oxysulfonyloxy-2,2-dimethylbutanoate (PubChem CID 137436596) has the molecular formula C16H29N3O8S and a molecular weight of 423.49 g/mol. Its IUPAC name is ethyl 3-[carbamoyl-(4-carbamoylcyclohexyl)amino]oxysulfonyloxy-2,2-dimethylbutanoate.
| Compound Name | ethyl 3-[carbamoyl-(4-carbamoylcyclohexyl)amino]oxysulfonyloxy-2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 137436596 |
| Molecular Formula | C16H29N3O8S |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | ethyl 3-[carbamoyl-(4-carbamoylcyclohexyl)amino]oxysulfonyloxy-2,2-dimethylbutanoate |
| SMILES | CCOC(=O)C(C)(C)C(C)OS(=O)(=O)ON(C(N)=O)C1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C16H29N3O8S/c1-5-25-14(21)16(3,4)10(2)26-28(23,24)27-19(15(18)22)12-8-6-11(7-9-12)13(17)20/h10-12H,5-9H2,1-4H3,(H2,17,20)(H2,18,22) |
| InChIKey | ZMDMAPAAMCRWTR-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 168.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|