C19H36O10S2 — CID 88862917
ethyl 3-[3-(4-ethoxy-3,3-dimethyl-4-oxobutan-2-yl)oxysulfonylpropylsulfonyloxy]-2,2-dimethylbutanoate (PubChem CID 88862917) has the molecular formula C19H36O10S2 and a molecular weight of 488.62 g/mol. Its IUPAC name is ethyl 3-[3-(4-ethoxy-3,3-dimethyl-4-oxobutan-2-yl)oxysulfonylpropylsulfonyloxy]-2,2-dimethylbutanoate.
| Compound Name | ethyl 3-[3-(4-ethoxy-3,3-dimethyl-4-oxobutan-2-yl)oxysulfonylpropylsulfonyloxy]-2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 88862917 |
| Molecular Formula | C19H36O10S2 |
| Molecular Weight | 488.62 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | ethyl 3-[3-(4-ethoxy-3,3-dimethyl-4-oxobutan-2-yl)oxysulfonylpropylsulfonyloxy]-2,2-dimethylbutanoate |
| SMILES | CCOC(=O)C(C)(C)C(C)OS(=O)(=O)CCCS(=O)(=O)OC(C)C(C)(C)C(=O)OCC |
| InChI | InChI=1S/C19H36O10S2/c1-9-26-16(20)18(5,6)14(3)28-30(22,23)12-11-13-31(24,25)29-15(4)19(7,8)17(21)27-10-2/h14-15H,9-13H2,1-8H3 |
| InChIKey | GAOFWSVHIQMNSV-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 139.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.62 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|