C15H30N2O10S2 — CID 75586509
bis(1-amino-4-hydroxy-3,3-dimethyl-1-oxobutan-2-yl) propane-1,3-disulfonate (PubChem CID 75586509) has the molecular formula C15H30N2O10S2 and a molecular weight of 462.54 g/mol. Its IUPAC name is bis(1-amino-4-hydroxy-3,3-dimethyl-1-oxobutan-2-yl) propane-1,3-disulfonate.
| Compound Name | bis(1-amino-4-hydroxy-3,3-dimethyl-1-oxobutan-2-yl) propane-1,3-disulfonate |
|---|---|
| PubChem CID | 75586509 |
| Molecular Formula | C15H30N2O10S2 |
| Molecular Weight | 462.54 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | bis(1-amino-4-hydroxy-3,3-dimethyl-1-oxobutan-2-yl) propane-1,3-disulfonate |
| SMILES | CC(C)(CO)C(OS(=O)(=O)CCCS(=O)(=O)OC(C(N)=O)C(C)(C)CO)C(N)=O |
| InChI | InChI=1S/C15H30N2O10S2/c1-14(2,8-18)10(12(16)20)26-28(22,23)6-5-7-29(24,25)27-11(13(17)21)15(3,4)9-19/h10-11,18-19H,5-9H2,1-4H3,(H2,16,20)(H2,17,21) |
| InChIKey | MUKNRZJANTXWMR-UHFFFAOYSA-N |
| XLogP | -2.19 |
| TPSA | 213.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.54 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|