C25H27BrN6O5 — CID 146365711
methyl 2-[[(3-bromo-1H-indol-2-yl)-hydroxymethyl]amino]-3-[[2-[3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]propanoate (PubChem CID 146365711) has the molecular formula C25H27BrN6O5 and a molecular weight of 571.43 g/mol. Its IUPAC name is methyl 2-[[(3-bromo-1H-indol-2-yl)-hydroxymethyl]amino]-3-[[2-[3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]propanoate.
| Compound Name | methyl 2-[[(3-bromo-1H-indol-2-yl)-hydroxymethyl]amino]-3-[[2-[3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 146365711 |
| Molecular Formula | C25H27BrN6O5 |
| Molecular Weight | 571.43 g/mol |
| Exact Mass | 570.12 |
| IUPAC Name | methyl 2-[[(3-bromo-1H-indol-2-yl)-hydroxymethyl]amino]-3-[[2-[3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]propanoate |
| SMILES | [H]/N=C(\N)c1ccc(C2=NOC(CC(=O)NCC(NC(O)c3[nH]c4ccccc4c3Br)C(=O)OC)C2)cc1 |
| InChI | InChI=1S/C25H27BrN6O5/c1-36-25(35)19(31-24(34)22-21(26)16-4-2-3-5-17(16)30-22)12-29-20(33)11-15-10-18(32-37-15)13-6-8-14(9-7-13)23(27)28/h2-9,15,19,24,30-31,34H,10-12H2,1H3,(H3,27,28)(H,29,33) |
| InChIKey | XCEFBAPXHKXWQH-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 174.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.43 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|