C29H28O13 — CID 146366182
[(2R,3R)-5-[3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxy-2-(3,4-dihydroxyphenyl)-7-hydroxy-3,4-dihydro-2H-chromen-3-yl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate (PubChem CID 146366182) has the molecular formula C29H28O13 and a molecular weight of 584.53 g/mol. Its IUPAC name is [(2R,3R)-5-[3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxy-2-(3,4-dihydroxyphenyl)-7-hydroxy-3,4-dihydro-2H-chromen-3-yl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate.
| Compound Name | [(2R,3R)-5-[3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxy-2-(3,4-dihydroxyphenyl)-7-hydroxy-3,4-dihydro-2H-chromen-3-yl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 146366182 |
| Molecular Formula | C29H28O13 |
| Molecular Weight | 584.53 g/mol |
| Exact Mass | 584.15 |
| IUPAC Name | [(2R,3R)-5-[3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxy-2-(3,4-dihydroxyphenyl)-7-hydroxy-3,4-dihydro-2H-chromen-3-yl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)O[C@@H]1Cc2c(OC3OCC(O)(CO)C3O)cc(O)cc2O[C@@H]1c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C29H28O13/c30-12-29(38)13-39-28(27(29)37)42-23-10-16(31)9-22-17(23)11-24(26(41-22)15-3-5-19(33)21(35)8-15)40-25(36)6-2-14-1-4-18(32)20(34)7-14/h1-10,24,26-28,30-35,37-38H,11-13H2/b6-2+/t24-,26-,27?,28?,29?/m1/s1 |
| InChIKey | LKXIFWYVZRJECP-OAHZPNBHSA-N |
| XLogP | 1.34 |
| TPSA | 215.83 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.53 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|