C15H11Cl2FN4O — CID 146370789
5-(azidomethyl)-N-[(3,4-dichlorophenyl)methyl]-2-fluorobenzamide (PubChem CID 146370789) has the molecular formula C15H11Cl2FN4O and a molecular weight of 353.18 g/mol. Its IUPAC name is 5-(azidomethyl)-N-[(3,4-dichlorophenyl)methyl]-2-fluorobenzamide.
| Compound Name | 5-(azidomethyl)-N-[(3,4-dichlorophenyl)methyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 146370789 |
| Molecular Formula | C15H11Cl2FN4O |
| Molecular Weight | 353.18 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | 5-(azidomethyl)-N-[(3,4-dichlorophenyl)methyl]-2-fluorobenzamide |
| SMILES | [N-]=[N+]=NCc1ccc(F)c(C(=O)NCc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C15H11Cl2FN4O/c16-12-3-1-10(6-13(12)17)7-20-15(23)11-5-9(8-21-22-19)2-4-14(11)18/h1-6H,7-8H2,(H,20,23) |
| InChIKey | ZMDCVAQTGCMJLZ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 77.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.18 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|