C8H7N3O3 — CID 146371420
(7-amino-1,3-benzoxazol-2-yl)carbamic acid (PubChem CID 146371420) has the molecular formula C8H7N3O3 and a molecular weight of 193.16 g/mol. Its IUPAC name is (7-amino-1,3-benzoxazol-2-yl)carbamic acid.
| Compound Name | (7-amino-1,3-benzoxazol-2-yl)carbamic acid |
|---|---|
| PubChem CID | 146371420 |
| Molecular Formula | C8H7N3O3 |
| Molecular Weight | 193.16 g/mol |
| Exact Mass | 193.05 |
| IUPAC Name | (7-amino-1,3-benzoxazol-2-yl)carbamic acid |
| SMILES | Nc1cccc2nc(NC(=O)O)oc12 |
| InChI | InChI=1S/C8H7N3O3/c9-4-2-1-3-5-6(4)14-7(10-5)11-8(12)13/h1-3H,9H2,(H,10,11)(H,12,13) |
| InChIKey | NPTRIUDJSYDYKN-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.16 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|