C19H41N — CID 146383769
2,3,4,5,6,7,8,9,9-nonamethyldecan-1-amine (PubChem CID 146383769) has the molecular formula C19H41N and a molecular weight of 283.54 g/mol. Its IUPAC name is 2,3,4,5,6,7,8,9,9-nonamethyldecan-1-amine.
| Compound Name | 2,3,4,5,6,7,8,9,9-nonamethyldecan-1-amine |
|---|---|
| PubChem CID | 146383769 |
| Molecular Formula | C19H41N |
| Molecular Weight | 283.54 g/mol |
| Exact Mass | 283.32 |
| IUPAC Name | 2,3,4,5,6,7,8,9,9-nonamethyldecan-1-amine |
| SMILES | CC(CN)C(C)C(C)C(C)C(C)C(C)C(C)C(C)(C)C |
| InChI | InChI=1S/C19H41N/c1-12(11-20)13(2)14(3)15(4)16(5)17(6)18(7)19(8,9)10/h12-18H,11,20H2,1-10H3 |
| InChIKey | YEDALRZDPZUJOK-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.54 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |