C8H16O6S — CID 146385308
methyl 2-[(2R,3S,5R)-3-hydroxy-5-methoxyoxolan-2-yl]ethanesulfonate (PubChem CID 146385308) has the molecular formula C8H16O6S and a molecular weight of 240.28 g/mol. Its IUPAC name is methyl 2-[(2R,3S,5R)-3-hydroxy-5-methoxyoxolan-2-yl]ethanesulfonate.
| Compound Name | methyl 2-[(2R,3S,5R)-3-hydroxy-5-methoxyoxolan-2-yl]ethanesulfonate |
|---|---|
| PubChem CID | 146385308 |
| Molecular Formula | C8H16O6S |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | methyl 2-[(2R,3S,5R)-3-hydroxy-5-methoxyoxolan-2-yl]ethanesulfonate |
| SMILES | CO[C@H]1C[C@H](O)[C@@H](CCS(=O)(=O)OC)O1 |
| InChI | InChI=1S/C8H16O6S/c1-12-8-5-6(9)7(14-8)3-4-15(10,11)13-2/h6-9H,3-5H2,1-2H3/t6-,7+,8+/m0/s1 |
| InChIKey | VOPUDMFIUGPDBL-XLPZGREQSA-N |
| XLogP | -0.52 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|