C32H36FNO5 — CID 146389706
ethyl 4-[3-[bis[(4-methoxyphenyl)methyl]amino]-2-fluoro-5-methylphenyl]-2-oxocyclohexane-1-carboxylate (PubChem CID 146389706) has the molecular formula C32H36FNO5 and a molecular weight of 533.64 g/mol. Its IUPAC name is ethyl 4-[3-[bis[(4-methoxyphenyl)methyl]amino]-2-fluoro-5-methylphenyl]-2-oxocyclohexane-1-carboxylate.
| Compound Name | ethyl 4-[3-[bis[(4-methoxyphenyl)methyl]amino]-2-fluoro-5-methylphenyl]-2-oxocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 146389706 |
| Molecular Formula | C32H36FNO5 |
| Molecular Weight | 533.64 g/mol |
| Exact Mass | 533.26 |
| IUPAC Name | ethyl 4-[3-[bis[(4-methoxyphenyl)methyl]amino]-2-fluoro-5-methylphenyl]-2-oxocyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(c2cc(C)cc(N(Cc3ccc(OC)cc3)Cc3ccc(OC)cc3)c2F)CC1=O |
| InChI | InChI=1S/C32H36FNO5/c1-5-39-32(36)27-15-10-24(18-30(27)35)28-16-21(2)17-29(31(28)33)34(19-22-6-11-25(37-3)12-7-22)20-23-8-13-26(38-4)14-9-23/h6-9,11-14,16-17,24,27H,5,10,15,18-20H2,1-4H3 |
| InChIKey | WGNVDXLLYUMZBK-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.64 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|