C31H31F9O5S — CID 146390749
[3-[[1,1-difluoro-3-[[2-[4-pentyl-2-(trifluoromethyl)phenyl]-1-benzofuran-6-yl]sulfanyl]propoxy]-difluoromethoxy]-3,3-difluoropropyl] 2-methylprop-2-enoate (PubChem CID 146390749) has the molecular formula C31H31F9O5S and a molecular weight of 686.63 g/mol. Its IUPAC name is [3-[[1,1-difluoro-3-[[2-[4-pentyl-2-(trifluoromethyl)phenyl]-1-benzofuran-6-yl]sulfanyl]propoxy]-difluoromethoxy]-3,3-difluoropropyl] 2-methylprop-2-enoate.
| Compound Name | [3-[[1,1-difluoro-3-[[2-[4-pentyl-2-(trifluoromethyl)phenyl]-1-benzofuran-6-yl]sulfanyl]propoxy]-difluoromethoxy]-3,3-difluoropropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 146390749 |
| Molecular Formula | C31H31F9O5S |
| Molecular Weight | 686.63 g/mol |
| Exact Mass | 686.17 |
| IUPAC Name | [3-[[1,1-difluoro-3-[[2-[4-pentyl-2-(trifluoromethyl)phenyl]-1-benzofuran-6-yl]sulfanyl]propoxy]-difluoromethoxy]-3,3-difluoropropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC(F)(F)OC(F)(F)OC(F)(F)CCSc1ccc2cc(-c3ccc(CCCCC)cc3C(F)(F)F)oc2c1 |
| InChI | InChI=1S/C31H31F9O5S/c1-4-5-6-7-20-8-11-23(24(16-20)30(36,37)38)26-17-21-9-10-22(18-25(21)43-26)46-15-13-29(34,35)45-31(39,40)44-28(32,33)12-14-42-27(41)19(2)3/h8-11,16-18H,2,4-7,12-15H2,1,3H3 |
| InChIKey | NTDWNKXVCGHNJW-UHFFFAOYSA-N |
| XLogP | 10.61 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.63 |
| LogP ≤ 5 | 10.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|