C7H11F2N — CID 146393027
2-ethyl-4,5-difluoro-1-methyl-2,3-dihydropyrrole (PubChem CID 146393027) has the molecular formula C7H11F2N and a molecular weight of 147.17 g/mol. Its IUPAC name is 2-ethyl-4,5-difluoro-1-methyl-2,3-dihydropyrrole.
| Compound Name | 2-ethyl-4,5-difluoro-1-methyl-2,3-dihydropyrrole |
|---|---|
| PubChem CID | 146393027 |
| Molecular Formula | C7H11F2N |
| Molecular Weight | 147.17 g/mol |
| Exact Mass | 147.09 |
| IUPAC Name | 2-ethyl-4,5-difluoro-1-methyl-2,3-dihydropyrrole |
| SMILES | CCC1CC(F)=C(F)N1C |
| InChI | InChI=1S/C7H11F2N/c1-3-5-4-6(8)7(9)10(5)2/h5H,3-4H2,1-2H3 |
| InChIKey | KGAOWQDBLDBNRF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.17 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|