C24H40N2O11 — CID 146393899
prop-2-enyl 3-[[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]-[3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propoxymethyl]amino]propanoate (PubChem CID 146393899) has the molecular formula C24H40N2O11 and a molecular weight of 532.59 g/mol. Its IUPAC name is prop-2-enyl 3-[[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]-[3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propoxymethyl]amino]propanoate.
| Compound Name | prop-2-enyl 3-[[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]-[3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propoxymethyl]amino]propanoate |
|---|---|
| PubChem CID | 146393899 |
| Molecular Formula | C24H40N2O11 |
| Molecular Weight | 532.59 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | prop-2-enyl 3-[[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]-[3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propoxymethyl]amino]propanoate |
| SMILES | C=CCOC(=O)CCN(CCC(=O)ON1C(=O)CCC1=O)COCCCOCCOCCOCCOC |
| InChI | InChI=1S/C24H40N2O11/c1-3-11-36-23(29)7-9-25(10-8-24(30)37-26-21(27)5-6-22(26)28)20-35-13-4-12-32-16-17-34-19-18-33-15-14-31-2/h3H,1,4-20H2,2H3 |
| InChIKey | COLAYZYXKXIJFR-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 139.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.59 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|