About Diphenylthallanyl--water (1/1)
Diphenylthallanyl--water (1/1) (PubChem CID 14639556) has the molecular formula C12H12OTl
and a molecular weight of 376.61 g/mol.
Molecular Properties
| Compound Name | Diphenylthallanyl--water (1/1) |
| PubChem CID | 14639556 |
| Molecular Formula | C12H12OTl |
| Molecular Weight | 376.61 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | — |
| SMILES | O.c1ccc([Tl]c2ccccc2)cc1 |
| InChI | InChI=1S/2C6H5.H2O.Tl/c2*1-2-4-6-5-3-1;;/h2*1-5H;1H2; |
| InChIKey | WJJUZUUYPTWARC-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 31.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.61 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze Diphenylthallanyl--water (1/1) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Diphenylthallanyl--water (1/1)?
The IUPAC name of Diphenylthallanyl--water (1/1) (CID 14639556) is not available.
What is the SMILES notation for Diphenylthallanyl--water (1/1)?
The canonical SMILES for Diphenylthallanyl--water (1/1) is O.c1ccc([Tl]c2ccccc2)cc1.
What is the InChIKey of Diphenylthallanyl--water (1/1)?
The InChIKey is WJJUZUUYPTWARC-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H5.H2O.Tl/c2*1-2-4-6-5-3-1;;/h2*1-5H;1H2;.
What are the key properties of Diphenylthallanyl--water (1/1)?
Diphenylthallanyl--water (1/1) has a molecular weight of 376.61 g/mol, XLogP of 0.52, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Diphenylthallanyl--water (1/1) is sourced from PubChem (CID 14639556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).