C16H15ClN7O2S- — CID 146401636
5-chloro-2-[(1-methylpyrazol-4-yl)amino]-4-[3-[1-(sulfinatoamino)ethenyl]anilino]pyrimidine (PubChem CID 146401636) has the molecular formula C16H15ClN7O2S- and a molecular weight of 404.86 g/mol. Its IUPAC name is 5-chloro-2-[(1-methylpyrazol-4-yl)amino]-4-[3-[1-(sulfinatoamino)ethenyl]anilino]pyrimidine.
| Compound Name | 5-chloro-2-[(1-methylpyrazol-4-yl)amino]-4-[3-[1-(sulfinatoamino)ethenyl]anilino]pyrimidine |
|---|---|
| PubChem CID | 146401636 |
| Molecular Formula | C16H15ClN7O2S- |
| Molecular Weight | 404.86 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | 5-chloro-2-[(1-methylpyrazol-4-yl)amino]-4-[3-[1-(sulfinatoamino)ethenyl]anilino]pyrimidine |
| SMILES | C=C(NS(=O)[O-])c1cccc(Nc2nc(Nc3cnn(C)c3)ncc2Cl)c1 |
| InChI | InChI=1S/C16H16ClN7O2S/c1-10(23-27(25)26)11-4-3-5-12(6-11)20-15-14(17)8-18-16(22-15)21-13-7-19-24(2)9-13/h3-9,23H,1H2,2H3,(H,25,26)(H2,18,20,21,22)/p-1 |
| InChIKey | MAUZTTCFVSZQSC-UHFFFAOYSA-M |
| XLogP | 2.71 |
| TPSA | 119.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.86 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|