C11H17NO5S — CID 146403100
1-(6-ethoxy-5-methoxy-2-pyridinyl)-2-methylsulfonylethanol (PubChem CID 146403100) has the molecular formula C11H17NO5S and a molecular weight of 275.33 g/mol. Its IUPAC name is 1-(6-ethoxy-5-methoxy-2-pyridinyl)-2-methylsulfonylethanol.
| Compound Name | 1-(6-ethoxy-5-methoxy-2-pyridinyl)-2-methylsulfonylethanol |
|---|---|
| PubChem CID | 146403100 |
| Molecular Formula | C11H17NO5S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 1-(6-ethoxy-5-methoxy-2-pyridinyl)-2-methylsulfonylethanol |
| SMILES | CCOc1nc(C(O)CS(C)(=O)=O)ccc1OC |
| InChI | InChI=1S/C11H17NO5S/c1-4-17-11-10(16-2)6-5-8(12-11)9(13)7-18(3,14)15/h5-6,9,13H,4,7H2,1-3H3 |
| InChIKey | XUSGGRZWYFLDQZ-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 85.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |