C18H20N4O3 — CID 146403591
1-(4,4-dimethyl-2,3-dihydro-1H-quinolin-6-yl)-3-(4-nitrophenyl)urea (PubChem CID 146403591) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is 1-(4,4-dimethyl-2,3-dihydro-1H-quinolin-6-yl)-3-(4-nitrophenyl)urea.
| Compound Name | 1-(4,4-dimethyl-2,3-dihydro-1H-quinolin-6-yl)-3-(4-nitrophenyl)urea |
|---|---|
| PubChem CID | 146403591 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 1-(4,4-dimethyl-2,3-dihydro-1H-quinolin-6-yl)-3-(4-nitrophenyl)urea |
| SMILES | CC1(C)CCNc2ccc(NC(=O)Nc3ccc([N+](=O)[O-])cc3)cc21 |
| InChI | InChI=1S/C18H20N4O3/c1-18(2)9-10-19-16-8-5-13(11-15(16)18)21-17(23)20-12-3-6-14(7-4-12)22(24)25/h3-8,11,19H,9-10H2,1-2H3,(H2,20,21,23) |
| InChIKey | YCKCCGFFWOWSIU-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|