C34H28N6O6 — CID 177404127
1-[7-tert-butyl-3-[(4-nitrophenyl)carbamoylamino]pyren-1-yl]-3-(4-nitrophenyl)urea (PubChem CID 177404127) has the molecular formula C34H28N6O6 and a molecular weight of 616.63 g/mol. Its IUPAC name is 1-[7-tert-butyl-3-[(4-nitrophenyl)carbamoylamino]pyren-1-yl]-3-(4-nitrophenyl)urea.
| Compound Name | 1-[7-tert-butyl-3-[(4-nitrophenyl)carbamoylamino]pyren-1-yl]-3-(4-nitrophenyl)urea |
|---|---|
| PubChem CID | 177404127 |
| Molecular Formula | C34H28N6O6 |
| Molecular Weight | 616.63 g/mol |
| Exact Mass | 616.21 |
| IUPAC Name | 1-[7-tert-butyl-3-[(4-nitrophenyl)carbamoylamino]pyren-1-yl]-3-(4-nitrophenyl)urea |
| SMILES | CC(C)(C)c1cc2ccc3c(NC(=O)Nc4ccc([N+](=O)[O-])cc4)cc(NC(=O)Nc4ccc([N+](=O)[O-])cc4)c4ccc(c1)c2c34 |
| InChI | InChI=1S/C34H28N6O6/c1-34(2,3)21-16-19-4-14-26-28(37-32(41)35-22-6-10-24(11-7-22)39(43)44)18-29(27-15-5-20(17-21)30(19)31(26)27)38-33(42)36-23-8-12-25(13-9-23)40(45)46/h4-18H,1-3H3,(H2,35,37,41)(H2,36,38,42) |
| InChIKey | QRKYOPHSFSDWQM-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 168.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.63 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|