C36H32N6O6 — CID 136828720
1-[[7-tert-butyl-3-[[(4-nitrophenyl)carbamoylamino]methyl]pyren-1-yl]methyl]-3-(4-nitrophenyl)urea (PubChem CID 136828720) has the molecular formula C36H32N6O6 and a molecular weight of 644.69 g/mol. Its IUPAC name is 1-[[7-tert-butyl-3-[[(4-nitrophenyl)carbamoylamino]methyl]pyren-1-yl]methyl]-3-(4-nitrophenyl)urea.
| Compound Name | 1-[[7-tert-butyl-3-[[(4-nitrophenyl)carbamoylamino]methyl]pyren-1-yl]methyl]-3-(4-nitrophenyl)urea |
|---|---|
| PubChem CID | 136828720 |
| Molecular Formula | C36H32N6O6 |
| Molecular Weight | 644.69 g/mol |
| Exact Mass | 644.24 |
| IUPAC Name | 1-[[7-tert-butyl-3-[[(4-nitrophenyl)carbamoylamino]methyl]pyren-1-yl]methyl]-3-(4-nitrophenyl)urea |
| SMILES | CC(C)(C)c1cc2ccc3c(CNC(=O)Nc4ccc([N+](=O)[O-])cc4)cc(CNC(=O)Nc4ccc([N+](=O)[O-])cc4)c4ccc(c1)c2c34 |
| InChI | InChI=1S/C36H32N6O6/c1-36(2,3)25-17-21-4-14-30-23(19-37-34(43)39-26-6-10-28(11-7-26)41(45)46)16-24(31-15-5-22(18-25)32(21)33(30)31)20-38-35(44)40-27-8-12-29(13-9-27)42(47)48/h4-18H,19-20H2,1-3H3,(H2,37,39,43)(H2,38,40,44) |
| InChIKey | KLEYTMMKYTXNJR-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 168.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.69 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|