C23H23ClN4O6 — CID 146403790
10-(3-chloro-4-nitrophenoxy)-5-(3-pyrrolidin-1-ylpropoxy)-2,3-dihydro-[1,4]dioxino[2,3-f]quinazoline (PubChem CID 146403790) has the molecular formula C23H23ClN4O6 and a molecular weight of 486.91 g/mol. Its IUPAC name is 10-(3-chloro-4-nitrophenoxy)-5-(3-pyrrolidin-1-ylpropoxy)-2,3-dihydro-[1,4]dioxino[2,3-f]quinazoline.
| Compound Name | 10-(3-chloro-4-nitrophenoxy)-5-(3-pyrrolidin-1-ylpropoxy)-2,3-dihydro-[1,4]dioxino[2,3-f]quinazoline |
|---|---|
| PubChem CID | 146403790 |
| Molecular Formula | C23H23ClN4O6 |
| Molecular Weight | 486.91 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | 10-(3-chloro-4-nitrophenoxy)-5-(3-pyrrolidin-1-ylpropoxy)-2,3-dihydro-[1,4]dioxino[2,3-f]quinazoline |
| SMILES | O=[N+]([O-])c1ccc(Oc2ncnc3cc(OCCCN4CCCC4)c4c(c23)OCCO4)cc1Cl |
| InChI | InChI=1S/C23H23ClN4O6/c24-16-12-15(4-5-18(16)28(29)30)34-23-20-17(25-14-26-23)13-19(21-22(20)33-11-10-32-21)31-9-3-8-27-6-1-2-7-27/h4-5,12-14H,1-3,6-11H2 |
| InChIKey | ZCYFIOIDSYSUCN-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 109.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.91 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|