C21H30O5 — CID 146409174
(3S)-4-phenylmethoxy-2-prop-2-enyl-5-[[(4S)-2,2,4-trimethyl-1,3-dioxolan-4-yl]methyl]oxolan-3-ol (PubChem CID 146409174) has the molecular formula C21H30O5 and a molecular weight of 362.47 g/mol. Its IUPAC name is (3S)-4-phenylmethoxy-2-prop-2-enyl-5-[[(4S)-2,2,4-trimethyl-1,3-dioxolan-4-yl]methyl]oxolan-3-ol.
| Compound Name | (3S)-4-phenylmethoxy-2-prop-2-enyl-5-[[(4S)-2,2,4-trimethyl-1,3-dioxolan-4-yl]methyl]oxolan-3-ol |
|---|---|
| PubChem CID | 146409174 |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | (3S)-4-phenylmethoxy-2-prop-2-enyl-5-[[(4S)-2,2,4-trimethyl-1,3-dioxolan-4-yl]methyl]oxolan-3-ol |
| SMILES | C=CCC1OC(C[C@@]2(C)COC(C)(C)O2)C(OCc2ccccc2)[C@H]1O |
| InChI | InChI=1S/C21H30O5/c1-5-9-16-18(22)19(23-13-15-10-7-6-8-11-15)17(25-16)12-21(4)14-24-20(2,3)26-21/h5-8,10-11,16-19,22H,1,9,12-14H2,2-4H3/t16?,17?,18-,19?,21-/m0/s1 |
| InChIKey | RCDHWFRIQMHXGX-QUHNBWEVSA-N |
| XLogP | 3.21 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|