C9H8Cl2N4 — CID 146409718
2-(2,4-dichloro-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl)acetonitrile (PubChem CID 146409718) has the molecular formula C9H8Cl2N4 and a molecular weight of 243.10 g/mol. Its IUPAC name is 2-(2,4-dichloro-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl)acetonitrile.
| Compound Name | 2-(2,4-dichloro-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl)acetonitrile |
|---|---|
| PubChem CID | 146409718 |
| Molecular Formula | C9H8Cl2N4 |
| Molecular Weight | 243.10 g/mol |
| Exact Mass | 242.01 |
| IUPAC Name | 2-(2,4-dichloro-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl)acetonitrile |
| SMILES | N#CCN1CCc2c(Cl)nc(Cl)nc2C1 |
| InChI | InChI=1S/C9H8Cl2N4/c10-8-6-1-3-15(4-2-12)5-7(6)13-9(11)14-8/h1,3-5H2 |
| InChIKey | DINHURMOHSUSTQ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 52.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.10 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|