About ethane;2-(2-methyl-4-propan-2-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)acetonitrile
ethane;2-(2-methyl-4-propan-2-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)acetonitrile (PubChem CID 176926740) has the molecular formula C15H24N4
and a molecular weight of 260.38 g/mol. Its IUPAC name is ethane;2-(2-methyl-4-propan-2-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)acetonitrile.
Molecular Properties
| Compound Name | ethane;2-(2-methyl-4-propan-2-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)acetonitrile |
| PubChem CID | 176926740 |
| Molecular Formula | C15H24N4 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | ethane;2-(2-methyl-4-propan-2-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)acetonitrile |
| SMILES | CC.Cc1nc2c(c(C(C)C)n1)CN(CC#N)CC2 |
| InChI | InChI=1S/C13H18N4.C2H6/c1-9(2)13-11-8-17(7-5-14)6-4-12(11)15-10(3)16-13;1-2/h9H,4,6-8H2,1-3H3;1-2H3 |
| InChIKey | ATKNBBPVCTWAMF-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 52.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-(2-methyl-4-propan-2-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-(2-methyl-4-propan-2-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)acetonitrile?
The IUPAC name of ethane;2-(2-methyl-4-propan-2-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)acetonitrile (CID 176926740) is ethane;2-(2-methyl-4-propan-2-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)acetonitrile.
What is the SMILES notation for ethane;2-(2-methyl-4-propan-2-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)acetonitrile?
The canonical SMILES for ethane;2-(2-methyl-4-propan-2-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)acetonitrile is CC.Cc1nc2c(c(C(C)C)n1)CN(CC#N)CC2.
What is the InChIKey of ethane;2-(2-methyl-4-propan-2-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)acetonitrile?
The InChIKey is ATKNBBPVCTWAMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N4.C2H6/c1-9(2)13-11-8-17(7-5-14)6-4-12(11)15-10(3)16-13;1-2/h9H,4,6-8H2,1-3H3;1-2H3.
What are the key properties of ethane;2-(2-methyl-4-propan-2-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)acetonitrile?
ethane;2-(2-methyl-4-propan-2-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)acetonitrile has a molecular weight of 260.38 g/mol, XLogP of 2.82, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-(2-methyl-4-propan-2-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)acetonitrile is sourced from PubChem (CID 176926740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).