C20H40N4 — CID 146410228
5-tert-butyl-2-[3-methyl-3-(4-methylpiperazin-1-yl)butyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 146410228) has the molecular formula C20H40N4 and a molecular weight of 336.57 g/mol. Its IUPAC name is 5-tert-butyl-2-[3-methyl-3-(4-methylpiperazin-1-yl)butyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | 5-tert-butyl-2-[3-methyl-3-(4-methylpiperazin-1-yl)butyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 146410228 |
| Molecular Formula | C20H40N4 |
| Molecular Weight | 336.57 g/mol |
| Exact Mass | 336.33 |
| IUPAC Name | 5-tert-butyl-2-[3-methyl-3-(4-methylpiperazin-1-yl)butyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | CN1CCN(C(C)(C)CCN2CC3CN(C(C)(C)C)CC3C2)CC1 |
| InChI | InChI=1S/C20H40N4/c1-19(2,3)24-15-17-13-22(14-18(17)16-24)8-7-20(4,5)23-11-9-21(6)10-12-23/h17-18H,7-16H2,1-6H3 |
| InChIKey | FYGDBGYFIZJGQD-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.57 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |