C22H23NO4 — CID 146416906
3-hydroxy-8-(3-hydroxypropoxy)-5,6,6-trimethylbenzo[b]carbazol-11-one (PubChem CID 146416906) has the molecular formula C22H23NO4 and a molecular weight of 365.43 g/mol. Its IUPAC name is 3-hydroxy-8-(3-hydroxypropoxy)-5,6,6-trimethylbenzo[b]carbazol-11-one.
| Compound Name | 3-hydroxy-8-(3-hydroxypropoxy)-5,6,6-trimethylbenzo[b]carbazol-11-one |
|---|---|
| PubChem CID | 146416906 |
| Molecular Formula | C22H23NO4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 3-hydroxy-8-(3-hydroxypropoxy)-5,6,6-trimethylbenzo[b]carbazol-11-one |
| SMILES | Cn1c2c(c3ccc(O)cc31)C(=O)c1ccc(OCCCO)cc1C2(C)C |
| InChI | InChI=1S/C22H23NO4/c1-22(2)17-12-14(27-10-4-9-24)6-8-15(17)20(26)19-16-7-5-13(25)11-18(16)23(3)21(19)22/h5-8,11-12,24-25H,4,9-10H2,1-3H3 |
| InChIKey | URSYZUPOYXPGPP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|