C14H15F3N2O4 — CID 146425920
3-[[4-(trifluoromethyl)phenyl]methylamino]oxycarbonylpyrrolidine-1-carboxylic acid (PubChem CID 146425920) has the molecular formula C14H15F3N2O4 and a molecular weight of 332.28 g/mol. Its IUPAC name is 3-[[4-(trifluoromethyl)phenyl]methylamino]oxycarbonylpyrrolidine-1-carboxylic acid.
| Compound Name | 3-[[4-(trifluoromethyl)phenyl]methylamino]oxycarbonylpyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 146425920 |
| Molecular Formula | C14H15F3N2O4 |
| Molecular Weight | 332.28 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 3-[[4-(trifluoromethyl)phenyl]methylamino]oxycarbonylpyrrolidine-1-carboxylic acid |
| SMILES | O=C(ONCc1ccc(C(F)(F)F)cc1)C1CCN(C(=O)O)C1 |
| InChI | InChI=1S/C14H15F3N2O4/c15-14(16,17)11-3-1-9(2-4-11)7-18-23-12(20)10-5-6-19(8-10)13(21)22/h1-4,10,18H,5-8H2,(H,21,22) |
| InChIKey | BNAHLAGJHPAMDA-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.28 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|