C14H19N3O8 — CID 146426328
2-[[2-amino-2-(2,3-dimethoxy-6-nitrophenyl)ethyl]-(carboxymethyl)amino]acetic acid (PubChem CID 146426328) has the molecular formula C14H19N3O8 and a molecular weight of 357.32 g/mol. Its IUPAC name is 2-[[2-amino-2-(2,3-dimethoxy-6-nitrophenyl)ethyl]-(carboxymethyl)amino]acetic acid.
| Compound Name | 2-[[2-amino-2-(2,3-dimethoxy-6-nitrophenyl)ethyl]-(carboxymethyl)amino]acetic acid |
|---|---|
| PubChem CID | 146426328 |
| Molecular Formula | C14H19N3O8 |
| Molecular Weight | 357.32 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 2-[[2-amino-2-(2,3-dimethoxy-6-nitrophenyl)ethyl]-(carboxymethyl)amino]acetic acid |
| SMILES | COc1ccc([N+](=O)[O-])c(C(N)CN(CC(=O)O)CC(=O)O)c1OC |
| InChI | InChI=1S/C14H19N3O8/c1-24-10-4-3-9(17(22)23)13(14(10)25-2)8(15)5-16(6-11(18)19)7-12(20)21/h3-4,8H,5-7,15H2,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | PKXHHMGXZSZPJN-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 165.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.32 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|