C20H27FO3 — CID 146428007
tert-butyl 2-[5-fluoro-2-(5-oxaspiro[2.5]octan-6-yl)phenyl]propanoate (PubChem CID 146428007) has the molecular formula C20H27FO3 and a molecular weight of 334.43 g/mol. Its IUPAC name is tert-butyl 2-[5-fluoro-2-(5-oxaspiro[2.5]octan-6-yl)phenyl]propanoate.
| Compound Name | tert-butyl 2-[5-fluoro-2-(5-oxaspiro[2.5]octan-6-yl)phenyl]propanoate |
|---|---|
| PubChem CID | 146428007 |
| Molecular Formula | C20H27FO3 |
| Molecular Weight | 334.43 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | tert-butyl 2-[5-fluoro-2-(5-oxaspiro[2.5]octan-6-yl)phenyl]propanoate |
| SMILES | CC(C(=O)OC(C)(C)C)c1cc(F)ccc1C1CCC2(CC2)CO1 |
| InChI | InChI=1S/C20H27FO3/c1-13(18(22)24-19(2,3)4)16-11-14(21)5-6-15(16)17-7-8-20(9-10-20)12-23-17/h5-6,11,13,17H,7-10,12H2,1-4H3 |
| InChIKey | PMZMCRDDKLOWEO-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.43 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |