C18H24BrFO3 — CID 146417593
tert-butyl 2-bromo-2-[2-(5,5-dimethyloxolan-2-yl)-5-fluorophenyl]acetate (PubChem CID 146417593) has the molecular formula C18H24BrFO3 and a molecular weight of 387.29 g/mol. Its IUPAC name is tert-butyl 2-bromo-2-[2-(5,5-dimethyloxolan-2-yl)-5-fluorophenyl]acetate.
| Compound Name | tert-butyl 2-bromo-2-[2-(5,5-dimethyloxolan-2-yl)-5-fluorophenyl]acetate |
|---|---|
| PubChem CID | 146417593 |
| Molecular Formula | C18H24BrFO3 |
| Molecular Weight | 387.29 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | tert-butyl 2-bromo-2-[2-(5,5-dimethyloxolan-2-yl)-5-fluorophenyl]acetate |
| SMILES | CC(C)(C)OC(=O)C(Br)c1cc(F)ccc1C1CCC(C)(C)O1 |
| InChI | InChI=1S/C18H24BrFO3/c1-17(2,3)23-16(21)15(19)13-10-11(20)6-7-12(13)14-8-9-18(4,5)22-14/h6-7,10,14-15H,8-9H2,1-5H3 |
| InChIKey | AMCIBMWGTIUGHU-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.29 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|