C24H38BrFO2 — CID 177029333
tert-butyl 2-bromo-2-[5-fluoro-2-(5,5,8-trimethylnonan-4-yl)phenyl]acetate (PubChem CID 177029333) has the molecular formula C24H38BrFO2 and a molecular weight of 457.47 g/mol. Its IUPAC name is tert-butyl 2-bromo-2-[5-fluoro-2-(5,5,8-trimethylnonan-4-yl)phenyl]acetate.
| Compound Name | tert-butyl 2-bromo-2-[5-fluoro-2-(5,5,8-trimethylnonan-4-yl)phenyl]acetate |
|---|---|
| PubChem CID | 177029333 |
| Molecular Formula | C24H38BrFO2 |
| Molecular Weight | 457.47 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | tert-butyl 2-bromo-2-[5-fluoro-2-(5,5,8-trimethylnonan-4-yl)phenyl]acetate |
| SMILES | CCCC(c1ccc(F)cc1C(Br)C(=O)OC(C)(C)C)C(C)(C)CCC(C)C |
| InChI | InChI=1S/C24H38BrFO2/c1-9-10-20(24(7,8)14-13-16(2)3)18-12-11-17(26)15-19(18)21(25)22(27)28-23(4,5)6/h11-12,15-16,20-21H,9-10,13-14H2,1-8H3 |
| InChIKey | PBGHMXLNQNRCMS-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.47 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|